C20H26N2O2S — CID 101383918
(2-sulfanylidene-1-pyridinyl) N-but-3-ynyl-N-[2-(3-ethylcyclohex-2-en-1-yl)ethyl]carbamate (PubChem CID 101383918) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) N-but-3-ynyl-N-[2-(3-ethylcyclohex-2-en-1-yl)ethyl]carbamate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) N-but-3-ynyl-N-[2-(3-ethylcyclohex-2-en-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 101383918 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) N-but-3-ynyl-N-[2-(3-ethylcyclohex-2-en-1-yl)ethyl]carbamate |
| SMILES | C#CCCN(CCC1C=C(CC)CCC1)C(=O)On1ccccc1=S |
| InChI | InChI=1S/C20H26N2O2S/c1-3-5-13-21(15-12-18-10-8-9-17(4-2)16-18)20(23)24-22-14-7-6-11-19(22)25/h1,6-7,11,14,16,18H,4-5,8-10,12-13,15H2,2H3 |
| InChIKey | PYWBXBJZILDPOK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|