C18H23NO3S — CID 10925653
(2-sulfanylidene-1-pyridinyl) (1S,8S)-12-oxobicyclo[6.3.1]dodecane-3-carboxylate (PubChem CID 10925653) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) (1S,8S)-12-oxobicyclo[6.3.1]dodecane-3-carboxylate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) (1S,8S)-12-oxobicyclo[6.3.1]dodecane-3-carboxylate |
|---|---|
| PubChem CID | 10925653 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) (1S,8S)-12-oxobicyclo[6.3.1]dodecane-3-carboxylate |
| SMILES | O=C(On1ccccc1=S)C1CCCC[C@H]2CCC[C@@H](C1)C2=O |
| InChI | InChI=1S/C18H23NO3S/c20-17-13-6-1-2-7-15(12-14(17)9-5-8-13)18(21)22-19-11-4-3-10-16(19)23/h3-4,10-11,13-15H,1-2,5-9,12H2/t13-,14-,15?/m0/s1 |
| InChIKey | PWEWOALZZKPFEY-ZYOSVBKOSA-N |
| XLogP | 3.74 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|