C13H15NO2S — CID 24807330
(2-sulfanylidene-1-pyridinyl) 2-(1-bicyclo[3.1.0]hexanyl)acetate (PubChem CID 24807330) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) 2-(1-bicyclo[3.1.0]hexanyl)acetate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) 2-(1-bicyclo[3.1.0]hexanyl)acetate |
|---|---|
| PubChem CID | 24807330 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) 2-(1-bicyclo[3.1.0]hexanyl)acetate |
| SMILES | O=C(CC12CCCC1C2)On1ccccc1=S |
| InChI | InChI=1S/C13H15NO2S/c15-12(9-13-6-3-4-10(13)8-13)16-14-7-2-1-5-11(14)17/h1-2,5,7,10H,3-4,6,8-9H2 |
| InChIKey | VNIPFXVYPQXKJK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|