C17H19NO2S — CID 10968634
(2-sulfanylidene-1-pyridinyl) 2-[(3aR,7aS)-3-methylidene-5,6,7,7a-tetrahydro-4H-inden-3a-yl]acetate (PubChem CID 10968634) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) 2-[(3aR,7aS)-3-methylidene-5,6,7,7a-tetrahydro-4H-inden-3a-yl]acetate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) 2-[(3aR,7aS)-3-methylidene-5,6,7,7a-tetrahydro-4H-inden-3a-yl]acetate |
|---|---|
| PubChem CID | 10968634 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) 2-[(3aR,7aS)-3-methylidene-5,6,7,7a-tetrahydro-4H-inden-3a-yl]acetate |
| SMILES | C=C1C=C[C@@H]2CCCC[C@]12CC(=O)On1ccccc1=S |
| InChI | InChI=1S/C17H19NO2S/c1-13-8-9-14-6-2-4-10-17(13,14)12-16(19)20-18-11-5-3-7-15(18)21/h3,5,7-9,11,14H,1-2,4,6,10,12H2/t14-,17-/m0/s1 |
| InChIKey | ONZXRUZCYXRMMO-YOEHRIQHSA-N |
| XLogP | 3.87 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|