C12H15ClO — CID 10059005
(2R)-2-[(3aR)-3-methylidene-5,6,7,7a-tetrahydro-4H-inden-3a-yl]-2-deuterioacetyl chloride (PubChem CID 10059005) has the molecular formula C12H15ClO and a molecular weight of 211.71 g/mol. Its IUPAC name is (2R)-2-[(3aR)-3-methylidene-5,6,7,7a-tetrahydro-4H-inden-3a-yl]-2-deuterioacetyl chloride.
| Compound Name | (2R)-2-[(3aR)-3-methylidene-5,6,7,7a-tetrahydro-4H-inden-3a-yl]-2-deuterioacetyl chloride |
|---|---|
| PubChem CID | 10059005 |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 211.71 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | (2R)-2-[(3aR)-3-methylidene-5,6,7,7a-tetrahydro-4H-inden-3a-yl]-2-deuterioacetyl chloride |
| SMILES | [2H][C@@H](C(=O)Cl)[C@]12CCCCC1C=CC2=C |
| InChI | InChI=1S/C12H15ClO/c1-9-5-6-10-4-2-3-7-12(9,10)8-11(13)14/h5-6,10H,1-4,7-8H2/t10?,12-/m0/s1/i8D/t8-,10?,12- |
| InChIKey | FPYIQMJZNSQLGC-VXXMPJEYSA-N |
| XLogP | 3.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|