C22H30Cl2O2 — CID 91740061
pentacyclo[6.6.6.02,7.09,14.015,20]icosane-1,8-dicarbonyl chloride (PubChem CID 91740061) has the molecular formula C22H30Cl2O2 and a molecular weight of 397.39 g/mol. Its IUPAC name is pentacyclo[6.6.6.02,7.09,14.015,20]icosane-1,8-dicarbonyl chloride.
| Compound Name | pentacyclo[6.6.6.02,7.09,14.015,20]icosane-1,8-dicarbonyl chloride |
|---|---|
| PubChem CID | 91740061 |
| Molecular Formula | C22H30Cl2O2 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | pentacyclo[6.6.6.02,7.09,14.015,20]icosane-1,8-dicarbonyl chloride |
| SMILES | O=C(Cl)C12C3CCCCC3C(C(=O)Cl)(C3CCCCC31)C1CCCCC12 |
| InChI | InChI=1S/C22H30Cl2O2/c23-19(25)21-13-7-1-2-8-14(13)22(20(24)26,17-11-5-3-9-15(17)21)18-12-6-4-10-16(18)21/h13-18H,1-12H2 |
| InChIKey | VIAZUWUMOHFQND-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|