C11H14O4-2 — CID 7057615
(1R,8R)-bicyclo[6.1.0]nonane-9,9-dicarboxylate (PubChem CID 7057615) has the molecular formula C11H14O4-2 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1R,8R)-bicyclo[6.1.0]nonane-9,9-dicarboxylate.
| Compound Name | (1R,8R)-bicyclo[6.1.0]nonane-9,9-dicarboxylate |
|---|---|
| PubChem CID | 7057615 |
| Molecular Formula | C11H14O4-2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (1R,8R)-bicyclo[6.1.0]nonane-9,9-dicarboxylate |
| SMILES | O=C([O-])C1(C(=O)[O-])[C@@H]2CCCCCC[C@H]21 |
| InChI | InChI=1S/C11H16O4/c12-9(13)11(10(14)15)7-5-3-1-2-4-6-8(7)11/h7-8H,1-6H2,(H,12,13)(H,14,15)/p-2/t7-,8-/m1/s1 |
| InChIKey | LGOHMXCZCZCTLH-HTQZYQBOSA-L |
| XLogP | -0.93 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|