C18H18O2 — CID 101384483
(1E,10E)-1-phenyldodeca-1,10-dien-7-yne-3,9-dione (PubChem CID 101384483) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1E,10E)-1-phenyldodeca-1,10-dien-7-yne-3,9-dione.
| Compound Name | (1E,10E)-1-phenyldodeca-1,10-dien-7-yne-3,9-dione |
|---|---|
| PubChem CID | 101384483 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (1E,10E)-1-phenyldodeca-1,10-dien-7-yne-3,9-dione |
| SMILES | C/C=C/C(=O)C#CCCCC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H18O2/c1-2-9-17(19)12-7-4-8-13-18(20)15-14-16-10-5-3-6-11-16/h2-3,5-6,9-11,14-15H,4,8,13H2,1H3/b9-2+,15-14+ |
| InChIKey | USRPJBCPUPSTGP-OKKGYJEMSA-N |
| XLogP | 3.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|