C56H58O10 — CID 101385506
[4-[3-methyl-2,3,4,5-tetrakis[4-(2-methylpropanoyloxy)phenyl]cyclopenta-1,4-dien-1-yl]phenyl] 2-methylpropanoate (PubChem CID 101385506) has the molecular formula C56H58O10 and a molecular weight of 891.07 g/mol. Its IUPAC name is [4-[3-methyl-2,3,4,5-tetrakis[4-(2-methylpropanoyloxy)phenyl]cyclopenta-1,4-dien-1-yl]phenyl] 2-methylpropanoate.
| Compound Name | [4-[3-methyl-2,3,4,5-tetrakis[4-(2-methylpropanoyloxy)phenyl]cyclopenta-1,4-dien-1-yl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 101385506 |
| Molecular Formula | C56H58O10 |
| Molecular Weight | 891.07 g/mol |
| Exact Mass | 890.40 |
| IUPAC Name | [4-[3-methyl-2,3,4,5-tetrakis[4-(2-methylpropanoyloxy)phenyl]cyclopenta-1,4-dien-1-yl]phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccc(C2=C(c3ccc(OC(=O)C(C)C)cc3)C(C)(c3ccc(OC(=O)C(C)C)cc3)C(c3ccc(OC(=O)C(C)C)cc3)=C2c2ccc(OC(=O)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C56H58O10/c1-32(2)51(57)62-42-22-12-37(13-23-42)47-48(38-14-24-43(25-15-38)63-52(58)33(3)4)50(40-18-28-45(29-19-40)65-54(60)35(7)8)56(11,41-20-30-46(31-21-41)66-55(61)36(9)10)49(47)39-16-26-44(27-17-39)64-53(59)34(5)6/h12-36H,1-11H3 |
| InChIKey | AFYYGXYKLVXWCH-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.07 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|