C28H38O3 — CID 126492563
[4-[2,3,4,5-tetramethyl-1-(4-propan-2-yloxyphenyl)cyclopentyl]phenyl] 2-methylpropanoate (PubChem CID 126492563) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is [4-[2,3,4,5-tetramethyl-1-(4-propan-2-yloxyphenyl)cyclopentyl]phenyl] 2-methylpropanoate.
| Compound Name | [4-[2,3,4,5-tetramethyl-1-(4-propan-2-yloxyphenyl)cyclopentyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 126492563 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | [4-[2,3,4,5-tetramethyl-1-(4-propan-2-yloxyphenyl)cyclopentyl]phenyl] 2-methylpropanoate |
| SMILES | CC(C)Oc1ccc(C2(c3ccc(OC(=O)C(C)C)cc3)C(C)C(C)C(C)C2C)cc1 |
| InChI | InChI=1S/C28H38O3/c1-17(2)27(29)31-26-15-11-24(12-16-26)28(21(7)19(5)20(6)22(28)8)23-9-13-25(14-10-23)30-18(3)4/h9-22H,1-8H3 |
| InChIKey | FRBSVCRJZHLSOK-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|