C23H24N2O5S — CID 101386371
(3aR,6R,7S,7aR)-2,2-dimethyl-3'-phenyl-7-phenylmethoxy-2'-sulfanylidenespiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6,5'-imidazolidine]-4'-one (PubChem CID 101386371) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is (3aR,6R,7S,7aR)-2,2-dimethyl-3'-phenyl-7-phenylmethoxy-2'-sulfanylidenespiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6,5'-imidazolidine]-4'-one.
| Compound Name | (3aR,6R,7S,7aR)-2,2-dimethyl-3'-phenyl-7-phenylmethoxy-2'-sulfanylidenespiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6,5'-imidazolidine]-4'-one |
|---|---|
| PubChem CID | 101386371 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (3aR,6R,7S,7aR)-2,2-dimethyl-3'-phenyl-7-phenylmethoxy-2'-sulfanylidenespiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6,5'-imidazolidine]-4'-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@]3(NC(=S)N(c4ccccc4)C3=O)[C@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C23H24N2O5S/c1-22(2)29-17-14-28-23(19(18(17)30-22)27-13-15-9-5-3-6-10-15)20(26)25(21(31)24-23)16-11-7-4-8-12-16/h3-12,17-19H,13-14H2,1-2H3,(H,24,31)/t17-,18-,19+,23-/m1/s1 |
| InChIKey | DLFMMUIWLLXKSL-CROMWVBPSA-N |
| XLogP | 2.74 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|