C16H21N3O5 — CID 102462898
[(3aR,6R,7S,7aR)-6-azido-2,2-dimethyl-7-phenylmethoxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]methanol (PubChem CID 102462898) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is [(3aR,6R,7S,7aR)-6-azido-2,2-dimethyl-7-phenylmethoxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]methanol.
| Compound Name | [(3aR,6R,7S,7aR)-6-azido-2,2-dimethyl-7-phenylmethoxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]methanol |
|---|---|
| PubChem CID | 102462898 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [(3aR,6R,7S,7aR)-6-azido-2,2-dimethyl-7-phenylmethoxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@](CO)(N=[N+]=[N-])[C@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C16H21N3O5/c1-15(2)23-12-9-22-16(10-20,18-19-17)14(13(12)24-15)21-8-11-6-4-3-5-7-11/h3-7,12-14,20H,8-10H2,1-2H3/t12-,13-,14+,16-/m1/s1 |
| InChIKey | BSDTVPKRGBFZRV-HGTKMLMNSA-N |
| XLogP | 2.12 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|