C21H27FN4O6 — CID 10138790
1,3-dihydroxypropan-2-yl (1S,5R)-3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexane-6-carboximidate (PubChem CID 10138790) has the molecular formula C21H27FN4O6 and a molecular weight of 450.47 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (1S,5R)-3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexane-6-carboximidate.
| Compound Name | 1,3-dihydroxypropan-2-yl (1S,5R)-3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexane-6-carboximidate |
|---|---|
| PubChem CID | 10138790 |
| Molecular Formula | C21H27FN4O6 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (1S,5R)-3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexane-6-carboximidate |
| SMILES | [H]/N=C(\OC(CO)CO)C1[C@H]2CN(c3ccc(N4C[C@H](CNC(C)=O)OC4=O)cc3F)C[C@@H]12 |
| InChI | InChI=1S/C21H27FN4O6/c1-11(29)24-5-13-6-26(21(30)32-13)12-2-3-18(17(22)4-12)25-7-15-16(8-25)19(15)20(23)31-14(9-27)10-28/h2-4,13-16,19,23,27-28H,5-10H2,1H3,(H,24,29)/b23-20-/t13-,15-,16+,19?/m0/s1 |
| InChIKey | GBSSATKZIDXUAV-PZNIRXINSA-N |
| XLogP | 0.32 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|