C22H29FN4O6 — CID 10205084
2-(2-hydroxyethoxy)ethyl (1S,5R)-3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexane-6-carboximidate (PubChem CID 10205084) has the molecular formula C22H29FN4O6 and a molecular weight of 464.49 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl (1S,5R)-3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexane-6-carboximidate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl (1S,5R)-3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexane-6-carboximidate |
|---|---|
| PubChem CID | 10205084 |
| Molecular Formula | C22H29FN4O6 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl (1S,5R)-3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexane-6-carboximidate |
| SMILES | [H]/N=C(\OCCOCCO)C1[C@H]2CN(c3ccc(N4C[C@H](CNC(C)=O)OC4=O)cc3F)C[C@@H]12 |
| InChI | InChI=1S/C22H29FN4O6/c1-13(29)25-9-15-10-27(22(30)33-15)14-2-3-19(18(23)8-14)26-11-16-17(12-26)20(16)21(24)32-7-6-31-5-4-28/h2-3,8,15-17,20,24,28H,4-7,9-12H2,1H3,(H,25,29)/b24-21-/t15-,16-,17+,20?/m0/s1 |
| InChIKey | QNDMWAVCTMKGPZ-JCXVKBRJSA-N |
| XLogP | 0.97 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|