C36H29N3OS — CID 101388958
(5Z,13E)-11-benzyl-5,13-dibenzylidene-8-phenyl-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2-dien-6-one (PubChem CID 101388958) has the molecular formula C36H29N3OS and a molecular weight of 551.72 g/mol. Its IUPAC name is (5Z,13E)-11-benzyl-5,13-dibenzylidene-8-phenyl-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2-dien-6-one.
| Compound Name | (5Z,13E)-11-benzyl-5,13-dibenzylidene-8-phenyl-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2-dien-6-one |
|---|---|
| PubChem CID | 101388958 |
| Molecular Formula | C36H29N3OS |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | (5Z,13E)-11-benzyl-5,13-dibenzylidene-8-phenyl-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2-dien-6-one |
| SMILES | O=c1/c(=C/c2ccccc2)sc2n1C(c1ccccc1)C1=C(N=2)/C(=C/c2ccccc2)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C36H29N3OS/c40-35-32(22-27-15-7-2-8-16-27)41-36-37-33-30(21-26-13-5-1-6-14-26)24-38(23-28-17-9-3-10-18-28)25-31(33)34(39(35)36)29-19-11-4-12-20-29/h1-22,34H,23-25H2/b30-21+,32-22- |
| InChIKey | RGANUPRQCKEWHS-NXQWWALTSA-N |
| XLogP | 5.81 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |