C22H34N2O2 — CID 101389995
N-[1-(tert-butylamino)-2-methyl-1-oxoheptan-2-yl]-N-prop-2-enylbenzamide (PubChem CID 101389995) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[1-(tert-butylamino)-2-methyl-1-oxoheptan-2-yl]-N-prop-2-enylbenzamide.
| Compound Name | N-[1-(tert-butylamino)-2-methyl-1-oxoheptan-2-yl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 101389995 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | N-[1-(tert-butylamino)-2-methyl-1-oxoheptan-2-yl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1ccccc1)C(C)(CCCCC)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H34N2O2/c1-7-9-13-16-22(6,20(26)23-21(3,4)5)24(17-8-2)19(25)18-14-11-10-12-15-18/h8,10-12,14-15H,2,7,9,13,16-17H2,1,3-6H3,(H,23,26) |
| InChIKey | CTFTYHIDMJETTC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|