C16H17Cl2NO3S — CID 101391211
1-amino-3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]propane-2-sulfonic acid (PubChem CID 101391211) has the molecular formula C16H17Cl2NO3S and a molecular weight of 374.29 g/mol. Its IUPAC name is 1-amino-3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]propane-2-sulfonic acid.
| Compound Name | 1-amino-3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]propane-2-sulfonic acid |
|---|---|
| PubChem CID | 101391211 |
| Molecular Formula | C16H17Cl2NO3S |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 1-amino-3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]propane-2-sulfonic acid |
| SMILES | NCC(Cc1ccc(Cl)cc1)(Cc1ccc(Cl)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C16H17Cl2NO3S/c17-14-5-1-12(2-6-14)9-16(11-19,23(20,21)22)10-13-3-7-15(18)8-4-13/h1-8H,9-11,19H2,(H,20,21,22) |
| InChIKey | LUISNLARKLGGPH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|