C16H16N2OS — CID 101392328
(3R,4R)-3-ethenyl-3-methyl-4-(4-methyl-1,3-thiazol-2-yl)-1-phenylazetidin-2-one (PubChem CID 101392328) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is (3R,4R)-3-ethenyl-3-methyl-4-(4-methyl-1,3-thiazol-2-yl)-1-phenylazetidin-2-one.
| Compound Name | (3R,4R)-3-ethenyl-3-methyl-4-(4-methyl-1,3-thiazol-2-yl)-1-phenylazetidin-2-one |
|---|---|
| PubChem CID | 101392328 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (3R,4R)-3-ethenyl-3-methyl-4-(4-methyl-1,3-thiazol-2-yl)-1-phenylazetidin-2-one |
| SMILES | C=C[C@@]1(C)C(=O)N(c2ccccc2)[C@H]1c1nc(C)cs1 |
| InChI | InChI=1S/C16H16N2OS/c1-4-16(3)13(14-17-11(2)10-20-14)18(15(16)19)12-8-6-5-7-9-12/h4-10,13H,1H2,2-3H3/t13-,16+/m0/s1 |
| InChIKey | OOIZWIIUFXQAFN-XJKSGUPXSA-N |
| XLogP | 3.73 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|