C25H35N3O3S — CID 10139270
ethyl 2-[[3-[2-(5-methyl-2-piperidin-1-yl-1,3-thiazol-4-yl)ethoxy]phenyl]methyl-prop-2-enylamino]acetate (PubChem CID 10139270) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is ethyl 2-[[3-[2-(5-methyl-2-piperidin-1-yl-1,3-thiazol-4-yl)ethoxy]phenyl]methyl-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[[3-[2-(5-methyl-2-piperidin-1-yl-1,3-thiazol-4-yl)ethoxy]phenyl]methyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 10139270 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | ethyl 2-[[3-[2-(5-methyl-2-piperidin-1-yl-1,3-thiazol-4-yl)ethoxy]phenyl]methyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)Cc1cccc(OCCc2nc(N3CCCCC3)sc2C)c1 |
| InChI | InChI=1S/C25H35N3O3S/c1-4-13-27(19-24(29)30-5-2)18-21-10-9-11-22(17-21)31-16-12-23-20(3)32-25(26-23)28-14-7-6-8-15-28/h4,9-11,17H,1,5-8,12-16,18-19H2,2-3H3 |
| InChIKey | NERBFASLCQKSSW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|