C18H24N2O3 — CID 101392786
3-(1-cyclohexyl-2-nitroethyl)-5-methoxy-2-methyl-1H-indole (PubChem CID 101392786) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-(1-cyclohexyl-2-nitroethyl)-5-methoxy-2-methyl-1H-indole.
| Compound Name | 3-(1-cyclohexyl-2-nitroethyl)-5-methoxy-2-methyl-1H-indole |
|---|---|
| PubChem CID | 101392786 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 3-(1-cyclohexyl-2-nitroethyl)-5-methoxy-2-methyl-1H-indole |
| SMILES | COc1ccc2[nH]c(C)c(C(C[N+](=O)[O-])C3CCCCC3)c2c1 |
| InChI | InChI=1S/C18H24N2O3/c1-12-18(15-10-14(23-2)8-9-17(15)19-12)16(11-20(21)22)13-6-4-3-5-7-13/h8-10,13,16,19H,3-7,11H2,1-2H3 |
| InChIKey | ZLWGRFWIRMGVFT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|