C23H42OSi — CID 101392984
trans-(2S,5R)-2,5-bis(2,2-dimethylpropyl)-2-(2-triethylsilylethynyl)cyclopentan-1-one (PubChem CID 101392984) has the molecular formula C23H42OSi and a molecular weight of 362.67 g/mol. Its IUPAC name is trans-(2S,5R)-2,5-bis(2,2-dimethylpropyl)-2-(2-triethylsilylethynyl)cyclopentan-1-one.
| Compound Name | trans-(2S,5R)-2,5-bis(2,2-dimethylpropyl)-2-(2-triethylsilylethynyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 101392984 |
| Molecular Formula | C23H42OSi |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | trans-(2S,5R)-2,5-bis(2,2-dimethylpropyl)-2-(2-triethylsilylethynyl)cyclopentan-1-one |
| SMILES | CC[Si](C#C[C@@]1(CC(C)(C)C)CC[C@H](CC(C)(C)C)C1=O)(CC)CC |
| InChI | InChI=1S/C23H42OSi/c1-10-25(11-2,12-3)16-15-23(18-22(7,8)9)14-13-19(20(23)24)17-21(4,5)6/h19H,10-14,17-18H2,1-9H3/t19-,23-/m1/s1 |
| InChIKey | AKDMRATUZAJSGB-AUSIDOKSSA-N |
| XLogP | 6.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|