C33H29NO4S2 — CID 101393519
3-[3-benzyl-1-(4-methylphenyl)sulfonyl-5-phenylsulfanylindol-4-yl]pentane-2,4-dione (PubChem CID 101393519) has the molecular formula C33H29NO4S2 and a molecular weight of 567.73 g/mol. Its IUPAC name is 3-[3-benzyl-1-(4-methylphenyl)sulfonyl-5-phenylsulfanylindol-4-yl]pentane-2,4-dione.
| Compound Name | 3-[3-benzyl-1-(4-methylphenyl)sulfonyl-5-phenylsulfanylindol-4-yl]pentane-2,4-dione |
|---|---|
| PubChem CID | 101393519 |
| Molecular Formula | C33H29NO4S2 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 3-[3-benzyl-1-(4-methylphenyl)sulfonyl-5-phenylsulfanylindol-4-yl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)c1c(Sc2ccccc2)ccc2c1c(Cc1ccccc1)cn2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H29NO4S2/c1-22-14-16-28(17-15-22)40(37,38)34-21-26(20-25-10-6-4-7-11-25)32-29(34)18-19-30(39-27-12-8-5-9-13-27)33(32)31(23(2)35)24(3)36/h4-19,21,31H,20H2,1-3H3 |
| InChIKey | LHAOFAWHYOWEHI-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 73.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|