C11H15NO6 — CID 101394658
(2R)-4-(acetyloxymethyl)-2-(methoxycarbonylamino)-3-methylidenepent-4-enoic acid (PubChem CID 101394658) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is (2R)-4-(acetyloxymethyl)-2-(methoxycarbonylamino)-3-methylidenepent-4-enoic acid.
| Compound Name | (2R)-4-(acetyloxymethyl)-2-(methoxycarbonylamino)-3-methylidenepent-4-enoic acid |
|---|---|
| PubChem CID | 101394658 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2R)-4-(acetyloxymethyl)-2-(methoxycarbonylamino)-3-methylidenepent-4-enoic acid |
| SMILES | C=C(COC(C)=O)C(=C)[C@@H](NC(=O)OC)C(=O)O |
| InChI | InChI=1S/C11H15NO6/c1-6(5-18-8(3)13)7(2)9(10(14)15)12-11(16)17-4/h9H,1-2,5H2,3-4H3,(H,12,16)(H,14,15)/t9-/m1/s1 |
| InChIKey | XYENYNBEFKXFFF-SECBINFHSA-N |
| XLogP | 0.47 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|