C17H16O4 — CID 101395621
4-methoxy-2,3-dimethylanthracene-1,5,9-triol (PubChem CID 101395621) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 4-methoxy-2,3-dimethylanthracene-1,5,9-triol.
| Compound Name | 4-methoxy-2,3-dimethylanthracene-1,5,9-triol |
|---|---|
| PubChem CID | 101395621 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-methoxy-2,3-dimethylanthracene-1,5,9-triol |
| SMILES | COc1c(C)c(C)c(O)c2c(O)c3cccc(O)c3cc12 |
| InChI | InChI=1S/C17H16O4/c1-8-9(2)17(21-3)12-7-11-10(5-4-6-13(11)18)16(20)14(12)15(8)19/h4-7,18-20H,1-3H3 |
| InChIKey | GYMJQOUNDOYJBA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|