C21H42O7Si2 — CID 101396085
ethyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-7-triethoxysilylhept-6-enoate (PubChem CID 101396085) has the molecular formula C21H42O7Si2 and a molecular weight of 462.73 g/mol. Its IUPAC name is ethyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-7-triethoxysilylhept-6-enoate.
| Compound Name | ethyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-7-triethoxysilylhept-6-enoate |
|---|---|
| PubChem CID | 101396085 |
| Molecular Formula | C21H42O7Si2 |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | ethyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-7-triethoxysilylhept-6-enoate |
| SMILES | CCOC(=O)CC(=O)C[C@H](/C=C/[Si](OCC)(OCC)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O7Si2/c1-10-24-20(23)17-18(22)16-19(28-29(8,9)21(5,6)7)14-15-30(25-11-2,26-12-3)27-13-4/h14-15,19H,10-13,16-17H2,1-9H3/b15-14+/t19-/m0/s1 |
| InChIKey | MXJVRNCIPZOBCN-IQGVVSCOSA-N |
| XLogP | 4.43 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|