C40H40O2P2 — CID 101396585
[(1Z,3Z)-1,4-bis(diphenylphosphoryl)deca-1,3-dienyl]benzene (PubChem CID 101396585) has the molecular formula C40H40O2P2 and a molecular weight of 614.71 g/mol. Its IUPAC name is [(1Z,3Z)-1,4-bis(diphenylphosphoryl)deca-1,3-dienyl]benzene.
| Compound Name | [(1Z,3Z)-1,4-bis(diphenylphosphoryl)deca-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 101396585 |
| Molecular Formula | C40H40O2P2 |
| Molecular Weight | 614.71 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | [(1Z,3Z)-1,4-bis(diphenylphosphoryl)deca-1,3-dienyl]benzene |
| SMILES | CCCCCC/C(=C/C=C(/c1ccccc1)P(=O)(c1ccccc1)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H40O2P2/c1-2-3-4-12-31-39(43(41,35-23-13-6-14-24-35)36-25-15-7-16-26-36)32-33-40(34-21-10-5-11-22-34)44(42,37-27-17-8-18-28-37)38-29-19-9-20-30-38/h5-11,13-30,32-33H,2-4,12,31H2,1H3/b39-32-,40-33- |
| InChIKey | CCJIHHWPAGHDIN-BTSNXRIWSA-N |
| XLogP | 9.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.71 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|