C21H24O — CID 101400046
2-[(1R,2R)-2,3,3-trimethyl-1-phenylbutyl]-1-benzofuran (PubChem CID 101400046) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-[(1R,2R)-2,3,3-trimethyl-1-phenylbutyl]-1-benzofuran.
| Compound Name | 2-[(1R,2R)-2,3,3-trimethyl-1-phenylbutyl]-1-benzofuran |
|---|---|
| PubChem CID | 101400046 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-[(1R,2R)-2,3,3-trimethyl-1-phenylbutyl]-1-benzofuran |
| SMILES | C[C@H]([C@H](c1ccccc1)c1cc2ccccc2o1)C(C)(C)C |
| InChI | InChI=1S/C21H24O/c1-15(21(2,3)4)20(16-10-6-5-7-11-16)19-14-17-12-8-9-13-18(17)22-19/h5-15,20H,1-4H3/t15-,20-/m1/s1 |
| InChIKey | VXOCSLYNCKOHQX-FOIQADDNSA-N |
| XLogP | 6.25 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |