C24H26N2O8 — CID 10140072
(4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-7-ethenyl-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 10140072) has the molecular formula C24H26N2O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-7-ethenyl-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-7-ethenyl-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 10140072 |
| Molecular Formula | C24H26N2O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-7-ethenyl-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C=Cc1ccc(O)c2c1[C@H](C)[C@@H]1C(C2=O)C(=O)[C@]2(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C24H26N2O8/c1-5-9-6-7-10(27)13-11(9)8(2)12-14(18(13)28)21(31)24(34)16(19(12)29)17(26(3)4)20(30)15(22(24)32)23(25)33/h5-8,12,14-17,19,27,29,34H,1H2,2-4H3,(H2,25,33)/t8-,12+,14?,15?,16+,17-,19-,24-/m0/s1 |
| InChIKey | LGHWDXWUYDINEC-XQEKKVPVSA-N |
| XLogP | -0.96 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|