C29H28N2O9 — CID 91180838
(4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-7-(3-formylphenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91180838) has the molecular formula C29H28N2O9 and a molecular weight of 548.55 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-7-(3-formylphenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-7-(3-formylphenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91180838 |
| Molecular Formula | C29H28N2O9 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-7-(3-formylphenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@H]1c2c(-c3cccc(C=O)c3)ccc(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C29H28N2O9/c1-11-16-14(13-6-4-5-12(9-13)10-32)7-8-15(33)18(16)23(34)19-17(11)24(35)21-22(31(2)3)25(36)20(28(30)39)27(38)29(21,40)26(19)37/h4-11,17,19-22,24,33,35,40H,1-3H3,(H2,30,39)/t11-,17+,19?,20?,21+,22-,24-,29-/m0/s1 |
| InChIKey | JAMUFQYEZTVEKY-JPIKUGLHSA-N |
| XLogP | -0.12 |
| TPSA | 192.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|