C33H30N2O9 — CID 91195600
(4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-7-(4-formylnaphthalen-1-yl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91195600) has the molecular formula C33H30N2O9 and a molecular weight of 598.61 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-7-(4-formylnaphthalen-1-yl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-7-(4-formylnaphthalen-1-yl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91195600 |
| Molecular Formula | C33H30N2O9 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | (4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-7-(4-formylnaphthalen-1-yl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@@H]1c2c(-c3ccc(C=O)c4ccccc34)ccc(O)c2C(=O)C2C(=O)[C@@]3(O)C(=O)C(C(N)=O)C(=O)[C@H](N(C)C)[C@H]3[C@H](O)[C@H]21 |
| InChI | InChI=1S/C33H30N2O9/c1-13-20-18(17-9-8-14(12-36)15-6-4-5-7-16(15)17)10-11-19(37)22(20)27(38)23-21(13)28(39)25-26(35(2)3)29(40)24(32(34)43)31(42)33(25,44)30(23)41/h4-13,21,23-26,28,37,39,44H,1-3H3,(H2,34,43)/t13-,21+,23?,24?,25+,26-,28-,33-/m1/s1 |
| InChIKey | RNVFPUKBCAIAIB-GAXONNLTSA-N |
| XLogP | 1.03 |
| TPSA | 192.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|