C42H56O8 — CID 101404156
(11-acetyloxy-1,4,5,8,9,12-hexadeuterio-3,6,7,10-tetrapentoxytriphenylen-2-yl) acetate (PubChem CID 101404156) has the molecular formula C42H56O8 and a molecular weight of 694.94 g/mol. Its IUPAC name is (11-acetyloxy-1,4,5,8,9,12-hexadeuterio-3,6,7,10-tetrapentoxytriphenylen-2-yl) acetate.
| Compound Name | (11-acetyloxy-1,4,5,8,9,12-hexadeuterio-3,6,7,10-tetrapentoxytriphenylen-2-yl) acetate |
|---|---|
| PubChem CID | 101404156 |
| Molecular Formula | C42H56O8 |
| Molecular Weight | 694.94 g/mol |
| Exact Mass | 694.44 |
| IUPAC Name | (11-acetyloxy-1,4,5,8,9,12-hexadeuterio-3,6,7,10-tetrapentoxytriphenylen-2-yl) acetate |
| SMILES | [2H]c1c(OCCCCC)c(OCCCCC)c([2H])c2c1c1c([2H])c(OCCCCC)c(OC(C)=O)c([2H])c1c1c([2H])c(OC(C)=O)c(OCCCCC)c([2H])c21 |
| InChI | InChI=1S/C42H56O8/c1-7-11-15-19-45-37-23-31-32(24-38(37)46-20-16-12-8-2)34-26-40(48-22-18-14-10-4)42(50-30(6)44)28-36(34)35-27-41(49-29(5)43)39(25-33(31)35)47-21-17-13-9-3/h23-28H,7-22H2,1-6H3/i23D,24D,25D,26D,27D,28D |
| InChIKey | MCKYOWWJJRPQKZ-VOUGGZJASA-N |
| XLogP | 11.27 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.94 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|