C19H27N3OSi — CID 101406679
2-phenyl-1-[1-(1-trimethylsilylhex-1-yn-3-yl)triazol-4-yl]ethanol (PubChem CID 101406679) has the molecular formula C19H27N3OSi and a molecular weight of 341.53 g/mol. Its IUPAC name is 2-phenyl-1-[1-(1-trimethylsilylhex-1-yn-3-yl)triazol-4-yl]ethanol.
| Compound Name | 2-phenyl-1-[1-(1-trimethylsilylhex-1-yn-3-yl)triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 101406679 |
| Molecular Formula | C19H27N3OSi |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-phenyl-1-[1-(1-trimethylsilylhex-1-yn-3-yl)triazol-4-yl]ethanol |
| SMILES | CCCC(C#C[Si](C)(C)C)n1cc(C(O)Cc2ccccc2)nn1 |
| InChI | InChI=1S/C19H27N3OSi/c1-5-9-17(12-13-24(2,3)4)22-15-18(20-21-22)19(23)14-16-10-7-6-8-11-16/h6-8,10-11,15,17,19,23H,5,9,14H2,1-4H3 |
| InChIKey | ASUACNLZZVCPHZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|