C6H12NO2+ — CID 101407381
4-azoniaspiro[3.3]heptane-2,6-diol (PubChem CID 101407381) has the molecular formula C6H12NO2+ and a molecular weight of 130.17 g/mol. Its IUPAC name is 4-azoniaspiro[3.3]heptane-2,6-diol.
| Compound Name | 4-azoniaspiro[3.3]heptane-2,6-diol |
|---|---|
| PubChem CID | 101407381 |
| Molecular Formula | C6H12NO2+ |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | 4-azoniaspiro[3.3]heptane-2,6-diol |
| SMILES | OC1C[N+]2(C1)CC(O)C2 |
| InChI | InChI=1S/C6H12NO2/c8-5-1-7(2-5)3-6(9)4-7/h5-6,8-9H,1-4H2/q+1 |
| InChIKey | HDKZWRBPFIPXIE-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|