C10H16O2 — CID 101407777
(4aS,9aR)-4a-methyl-2,3,4,8,9,9a-hexahydropyrano[3,2-b]oxepine (PubChem CID 101407777) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (4aS,9aR)-4a-methyl-2,3,4,8,9,9a-hexahydropyrano[3,2-b]oxepine.
| Compound Name | (4aS,9aR)-4a-methyl-2,3,4,8,9,9a-hexahydropyrano[3,2-b]oxepine |
|---|---|
| PubChem CID | 101407777 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (4aS,9aR)-4a-methyl-2,3,4,8,9,9a-hexahydropyrano[3,2-b]oxepine |
| SMILES | C[C@]12CCCO[C@@H]1CCC=CO2 |
| InChI | InChI=1S/C10H16O2/c1-10-6-4-7-11-9(10)5-2-3-8-12-10/h3,8-9H,2,4-7H2,1H3/t9-,10+/m1/s1 |
| InChIKey | NFWBTEAVNMMDIW-ZJUUUORDSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |