C18H26O4 — CID 101408095
methyl (1R,2R,6S,7S,8S,10S,12R)-1,4,4,10-tetramethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-10-carboxylate (PubChem CID 101408095) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is methyl (1R,2R,6S,7S,8S,10S,12R)-1,4,4,10-tetramethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-10-carboxylate.
| Compound Name | methyl (1R,2R,6S,7S,8S,10S,12R)-1,4,4,10-tetramethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-10-carboxylate |
|---|---|
| PubChem CID | 101408095 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | methyl (1R,2R,6S,7S,8S,10S,12R)-1,4,4,10-tetramethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-10-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@@H]2[C@@H]3C=C[C@](C)([C@@H]2C1)[C@H]1OC(C)(C)O[C@@H]31 |
| InChI | InChI=1S/C18H26O4/c1-16(2)21-13-10-6-7-18(4,14(13)22-16)12-9-17(3,8-11(10)12)15(19)20-5/h6-7,10-14H,8-9H2,1-5H3/t10-,11+,12+,13-,14-,17-,18+/m0/s1 |
| InChIKey | KUAMJSWGZPISOM-VBWPHSEPSA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|