C14H15NO7 — CID 101408331
4-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)ethoxy]-4-oxobutanoic acid (PubChem CID 101408331) has the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. Its IUPAC name is 4-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 101408331 |
| Molecular Formula | C14H15NO7 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-[2-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)ethoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OCCN1C(=O)C2C3C=CC(O3)C2C1=O |
| InChI | InChI=1S/C14H15NO7/c16-9(17)3-4-10(18)21-6-5-15-13(19)11-7-1-2-8(22-7)12(11)14(15)20/h1-2,7-8,11-12H,3-6H2,(H,16,17) |
| InChIKey | ANLRZVOAJZKWCX-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|