C26H31NO14S — CID 102110707
2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl 3-[(2S,3R,4S,5S,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]sulfanylpropanoate (PubChem CID 102110707) has the molecular formula C26H31NO14S and a molecular weight of 613.59 g/mol. Its IUPAC name is 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl 3-[(2S,3R,4S,5S,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]sulfanylpropanoate.
| Compound Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl 3-[(2S,3R,4S,5S,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 102110707 |
| Molecular Formula | C26H31NO14S |
| Molecular Weight | 613.59 g/mol |
| Exact Mass | 613.15 |
| IUPAC Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl 3-[(2S,3R,4S,5S,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]sulfanylpropanoate |
| SMILES | CC(=O)O[C@H]1O[C@@H](SCCC(=O)OCCN2C(=O)[C@@H]3C4C=CC(O4)[C@@H]3C2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H31NO14S/c1-11(28)36-20-21(37-12(2)29)25(39-14(4)31)41-26(22(20)38-13(3)30)42-10-7-17(32)35-9-8-27-23(33)18-15-5-6-16(40-15)19(18)24(27)34/h5-6,15-16,18-22,25-26H,7-10H2,1-4H3/t15?,16?,18-,19+,20-,21-,22+,25-,26-/m0/s1 |
| InChIKey | LXNYFJHUWBMXNI-NQOLRDPRSA-N |
| XLogP | -0.37 |
| TPSA | 187.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.59 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|