C19H27ClO3S — CID 101408424
tert-butyl 2-[1-[chloro-(4-methylphenyl)sulfinylmethyl]cyclopentyl]acetate (PubChem CID 101408424) has the molecular formula C19H27ClO3S and a molecular weight of 370.94 g/mol. Its IUPAC name is tert-butyl 2-[1-[chloro-(4-methylphenyl)sulfinylmethyl]cyclopentyl]acetate.
| Compound Name | tert-butyl 2-[1-[chloro-(4-methylphenyl)sulfinylmethyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 101408424 |
| Molecular Formula | C19H27ClO3S |
| Molecular Weight | 370.94 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | tert-butyl 2-[1-[chloro-(4-methylphenyl)sulfinylmethyl]cyclopentyl]acetate |
| SMILES | Cc1ccc(S(=O)C(Cl)C2(CC(=O)OC(C)(C)C)CCCC2)cc1 |
| InChI | InChI=1S/C19H27ClO3S/c1-14-7-9-15(10-8-14)24(22)17(20)19(11-5-6-12-19)13-16(21)23-18(2,3)4/h7-10,17H,5-6,11-13H2,1-4H3 |
| InChIKey | VIOJQRNBZLIJEC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.94 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|