C23H29ClO3S — CID 101422822
tert-butyl 4-chloro-4-(4-methylphenyl)sulfinyl-2-(2-phenylethyl)butanoate (PubChem CID 101422822) has the molecular formula C23H29ClO3S and a molecular weight of 421.00 g/mol. Its IUPAC name is tert-butyl 4-chloro-4-(4-methylphenyl)sulfinyl-2-(2-phenylethyl)butanoate.
| Compound Name | tert-butyl 4-chloro-4-(4-methylphenyl)sulfinyl-2-(2-phenylethyl)butanoate |
|---|---|
| PubChem CID | 101422822 |
| Molecular Formula | C23H29ClO3S |
| Molecular Weight | 421.00 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | tert-butyl 4-chloro-4-(4-methylphenyl)sulfinyl-2-(2-phenylethyl)butanoate |
| SMILES | Cc1ccc(S(=O)C(Cl)CC(CCc2ccccc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H29ClO3S/c1-17-10-14-20(15-11-17)28(26)21(24)16-19(22(25)27-23(2,3)4)13-12-18-8-6-5-7-9-18/h5-11,14-15,19,21H,12-13,16H2,1-4H3 |
| InChIKey | SXVIXPLKQVNMOA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.00 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|