C21H30O4 — CID 67719134
[2-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylbutyl] cyclopentanecarboxylate (PubChem CID 67719134) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylbutyl] cyclopentanecarboxylate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylbutyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 67719134 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylbutyl] cyclopentanecarboxylate |
| SMILES | CC(C)(C)OC(=O)C(CCc1ccccc1)COC(=O)C1CCCC1 |
| InChI | InChI=1S/C21H30O4/c1-21(2,3)25-20(23)18(14-13-16-9-5-4-6-10-16)15-24-19(22)17-11-7-8-12-17/h4-6,9-10,17-18H,7-8,11-15H2,1-3H3 |
| InChIKey | RBMVNPKFYWKBEJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |