C17H20O2S — CID 101410555
5,12-dimethyl-4,17-dioxa-8-thiatetracyclo[8.8.0.02,7.011,16]octadeca-5,11,13,15-tetraene (PubChem CID 101410555) has the molecular formula C17H20O2S and a molecular weight of 288.41 g/mol. Its IUPAC name is 5,12-dimethyl-4,17-dioxa-8-thiatetracyclo[8.8.0.02,7.011,16]octadeca-5,11,13,15-tetraene.
| Compound Name | 5,12-dimethyl-4,17-dioxa-8-thiatetracyclo[8.8.0.02,7.011,16]octadeca-5,11,13,15-tetraene |
|---|---|
| PubChem CID | 101410555 |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5,12-dimethyl-4,17-dioxa-8-thiatetracyclo[8.8.0.02,7.011,16]octadeca-5,11,13,15-tetraene |
| SMILES | CC1=CC2SCC3c4c(C)cccc4OCC3C2CO1 |
| InChI | InChI=1S/C17H20O2S/c1-10-4-3-5-15-17(10)14-9-20-16-6-11(2)18-8-13(16)12(14)7-19-15/h3-6,12-14,16H,7-9H2,1-2H3 |
| InChIKey | ZPSMQURJGJLPNR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |