C26H30F3N3O3 — CID 10141141
(2S)-2-methyl-3-(3-methylbutoxy)-N-[1-methyl-2-oxo-5-[4-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-3-yl]propanamide (PubChem CID 10141141) has the molecular formula C26H30F3N3O3 and a molecular weight of 489.54 g/mol. Its IUPAC name is (2S)-2-methyl-3-(3-methylbutoxy)-N-[1-methyl-2-oxo-5-[4-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-3-yl]propanamide.
| Compound Name | (2S)-2-methyl-3-(3-methylbutoxy)-N-[1-methyl-2-oxo-5-[4-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-3-yl]propanamide |
|---|---|
| PubChem CID | 10141141 |
| Molecular Formula | C26H30F3N3O3 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (2S)-2-methyl-3-(3-methylbutoxy)-N-[1-methyl-2-oxo-5-[4-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-3-yl]propanamide |
| SMILES | CC(C)CCOC[C@H](C)C(=O)NC1N=C(c2ccc(C(F)(F)F)cc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C26H30F3N3O3/c1-16(2)13-14-35-15-17(3)24(33)31-23-25(34)32(4)21-8-6-5-7-20(21)22(30-23)18-9-11-19(12-10-18)26(27,28)29/h5-12,16-17,23H,13-15H2,1-4H3,(H,31,33)/t17-,23?/m0/s1 |
| InChIKey | UHHQEYMBYNQULZ-NVHKAFQKSA-N |
| XLogP | 4.66 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|