C24H24N2O6S — CID 101411514
5,6-dimethoxy-2-(4-methylphenyl)sulfonyl-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 101411514) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is 5,6-dimethoxy-2-(4-methylphenyl)sulfonyl-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 5,6-dimethoxy-2-(4-methylphenyl)sulfonyl-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 101411514 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 5,6-dimethoxy-2-(4-methylphenyl)sulfonyl-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc2c(c1OC)CCN(S(=O)(=O)c1ccc(C)cc1)C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H24N2O6S/c1-16-4-10-19(11-5-16)33(29,30)25-15-14-21-20(12-13-22(31-2)24(21)32-3)23(25)17-6-8-18(9-7-17)26(27)28/h4-13,23H,14-15H2,1-3H3 |
| InChIKey | LCZDKNPWMOOXMJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|