C22H24INO3 — CID 101412894
tert-butyl (4S,5R)-2-benzyl-5-(iodomethyl)-4-phenyl-4H-1,3-oxazole-5-carboxylate (PubChem CID 101412894) has the molecular formula C22H24INO3 and a molecular weight of 477.34 g/mol. Its IUPAC name is tert-butyl (4S,5R)-2-benzyl-5-(iodomethyl)-4-phenyl-4H-1,3-oxazole-5-carboxylate.
| Compound Name | tert-butyl (4S,5R)-2-benzyl-5-(iodomethyl)-4-phenyl-4H-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 101412894 |
| Molecular Formula | C22H24INO3 |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | tert-butyl (4S,5R)-2-benzyl-5-(iodomethyl)-4-phenyl-4H-1,3-oxazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(CI)OC(Cc2ccccc2)=N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H24INO3/c1-21(2,3)27-20(25)22(15-23)19(17-12-8-5-9-13-17)24-18(26-22)14-16-10-6-4-7-11-16/h4-13,19H,14-15H2,1-3H3/t19-,22+/m0/s1 |
| InChIKey | UIBLEKLHDVVYFV-SIKLNZKXSA-N |
| XLogP | 4.91 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|