C16H24O — CID 101413425
3,4,4,5-tetramethyl-1-phenylhex-5-en-3-ol (PubChem CID 101413425) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 3,4,4,5-tetramethyl-1-phenylhex-5-en-3-ol.
| Compound Name | 3,4,4,5-tetramethyl-1-phenylhex-5-en-3-ol |
|---|---|
| PubChem CID | 101413425 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 3,4,4,5-tetramethyl-1-phenylhex-5-en-3-ol |
| SMILES | C=C(C)C(C)(C)C(C)(O)CCc1ccccc1 |
| InChI | InChI=1S/C16H24O/c1-13(2)15(3,4)16(5,17)12-11-14-9-7-6-8-10-14/h6-10,17H,1,11-12H2,2-5H3 |
| InChIKey | KPZHJBWREPMENW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|