C24H33N — CID 142171230
2-methyl-4-[4-(4-phenylbutyl)phenyl]-N-prop-1-en-2-ylbutan-2-amine (PubChem CID 142171230) has the molecular formula C24H33N and a molecular weight of 335.54 g/mol. Its IUPAC name is 2-methyl-4-[4-(4-phenylbutyl)phenyl]-N-prop-1-en-2-ylbutan-2-amine.
| Compound Name | 2-methyl-4-[4-(4-phenylbutyl)phenyl]-N-prop-1-en-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 142171230 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 2-methyl-4-[4-(4-phenylbutyl)phenyl]-N-prop-1-en-2-ylbutan-2-amine |
| SMILES | C=C(C)NC(C)(C)CCc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H33N/c1-20(2)25-24(3,4)19-18-23-16-14-22(15-17-23)13-9-8-12-21-10-6-5-7-11-21/h5-7,10-11,14-17,25H,1,8-9,12-13,18-19H2,2-4H3 |
| InChIKey | MAXOKRXOGSRILW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|