C15H22O2 — CID 146167567
(2R,3R)-3-methyl-5-phenyl-2-prop-1-en-2-ylpentane-1,3-diol (PubChem CID 146167567) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (2R,3R)-3-methyl-5-phenyl-2-prop-1-en-2-ylpentane-1,3-diol.
| Compound Name | (2R,3R)-3-methyl-5-phenyl-2-prop-1-en-2-ylpentane-1,3-diol |
|---|---|
| PubChem CID | 146167567 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2R,3R)-3-methyl-5-phenyl-2-prop-1-en-2-ylpentane-1,3-diol |
| SMILES | C=C(C)[C@H](CO)[C@](C)(O)CCc1ccccc1 |
| InChI | InChI=1S/C15H22O2/c1-12(2)14(11-16)15(3,17)10-9-13-7-5-4-6-8-13/h4-8,14,16-17H,1,9-11H2,2-3H3/t14-,15+/m0/s1 |
| InChIKey | DUNPEMOLHZPQIX-LSDHHAIUSA-N |
| XLogP | 2.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|