C8H12O2 — CID 101414098
(2Z,4R)-4-hydroxycyclooct-2-en-1-one (PubChem CID 101414098) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (2Z,4R)-4-hydroxycyclooct-2-en-1-one.
| Compound Name | (2Z,4R)-4-hydroxycyclooct-2-en-1-one |
|---|---|
| PubChem CID | 101414098 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (2Z,4R)-4-hydroxycyclooct-2-en-1-one |
| SMILES | O=C1/C=C\[C@H](O)CCCC1 |
| InChI | InChI=1S/C8H12O2/c9-7-3-1-2-4-8(10)6-5-7/h5-7,9H,1-4H2/b6-5-/t7-/m1/s1 |
| InChIKey | XGSAMFHZWLJEOH-KXTMECRCSA-N |
| XLogP | 1.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |