C16H20O5 — CID 101414677
(2R,4aR,6S,8aR)-6-methoxy-7,7-dimethyl-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-one (PubChem CID 101414677) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (2R,4aR,6S,8aR)-6-methoxy-7,7-dimethyl-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-one.
| Compound Name | (2R,4aR,6S,8aR)-6-methoxy-7,7-dimethyl-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-one |
|---|---|
| PubChem CID | 101414677 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (2R,4aR,6S,8aR)-6-methoxy-7,7-dimethyl-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-one |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2C(=O)C1(C)C |
| InChI | InChI=1S/C16H20O5/c1-16(2)13(17)12-11(20-15(16)18-3)9-19-14(21-12)10-7-5-4-6-8-10/h4-8,11-12,14-15H,9H2,1-3H3/t11-,12-,14-,15+/m1/s1 |
| InChIKey | VSYWJSSMLULIIO-GBOPCIDUSA-N |
| XLogP | 2.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |