C22H24O7 — CID 4561528
methyl 2-O-benzyl-4,6-O-(4-methoxybenzylidene)hexopyranosid-3-ulose (PubChem CID 4561528) has the molecular formula C22H24O7 and a molecular weight of 400.40 g/mol. Its IUPAC name is 6-methoxy-2-(4-methoxyphenyl)-7-phenylmethoxy-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-one.
| Compound Name | methyl 2-O-benzyl-4,6-O-(4-methoxybenzylidene)hexopyranosid-3-ulose |
|---|---|
| PubChem CID | 4561528 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 6-methoxy-2-(4-methoxyphenyl)-7-phenylmethoxy-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-one |
| SMILES | COC1C(C(=O)C2C(O1)COC(O2)C3=CC=C(C=C3)OC)OCC4=CC=CC=C4 |
| InChI | InChI=1S/C22H24O7/c1-24-16-10-8-15(9-11-16)21-27-13-17-19(29-21)18(23)20(22(25-2)28-17)26-12-14-6-4-3-5-7-14/h3-11,17,19-22H,12-13H2,1-2H3 |
| InChIKey | VQDQWTWFTKEJMK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | 527 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |